C13H15NO2 — CID 100959529
1-(2-phenyloxetan-3-yl)pyrrolidin-2-one (PubChem CID 100959529) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-(2-phenyloxetan-3-yl)pyrrolidin-2-one.
| Compound Name | 1-(2-phenyloxetan-3-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 100959529 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-(2-phenyloxetan-3-yl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1C1COC1c1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c15-12-7-4-8-14(12)11-9-16-13(11)10-5-2-1-3-6-10/h1-3,5-6,11,13H,4,7-9H2 |
| InChIKey | LDINMNBYPKHNCH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |