C28H44N2O2 — CID 100959979
(1R,2R,3R,6S)-3,6-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]cyclohex-4-ene-1,2-dicarbonitrile (PubChem CID 100959979) has the molecular formula C28H44N2O2 and a molecular weight of 440.67 g/mol. Its IUPAC name is (1R,2R,3R,6S)-3,6-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]cyclohex-4-ene-1,2-dicarbonitrile.
| Compound Name | (1R,2R,3R,6S)-3,6-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]cyclohex-4-ene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 100959979 |
| Molecular Formula | C28H44N2O2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | (1R,2R,3R,6S)-3,6-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]cyclohex-4-ene-1,2-dicarbonitrile |
| SMILES | CC1CCC(C(C)C)C(O[C@H]2C=C[C@@H](OC3CC(C)CCC3C(C)C)[C@@H](C#N)[C@@H]2C#N)C1 |
| InChI | InChI=1S/C28H44N2O2/c1-17(2)21-9-7-19(5)13-27(21)31-25-11-12-26(24(16-30)23(25)15-29)32-28-14-20(6)8-10-22(28)18(3)4/h11-12,17-28H,7-10,13-14H2,1-6H3/t19?,20?,21?,22?,23-,24-,25-,26+,27?,28?/m0/s1 |
| InChIKey | XSFMHENAENJALY-ALNFAMBTSA-N |
| XLogP | 6.53 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|