C25H39NOSi — CID 100961896
[(3R)-4-ethyl-3-(1H-indol-3-yl)cyclohexen-1-yl]oxy-tri(propan-2-yl)silane (PubChem CID 100961896) has the molecular formula C25H39NOSi and a molecular weight of 397.68 g/mol. Its IUPAC name is [(3R)-4-ethyl-3-(1H-indol-3-yl)cyclohexen-1-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3R)-4-ethyl-3-(1H-indol-3-yl)cyclohexen-1-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 100961896 |
| Molecular Formula | C25H39NOSi |
| Molecular Weight | 397.68 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | [(3R)-4-ethyl-3-(1H-indol-3-yl)cyclohexen-1-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CCC1CCC(O[Si](C(C)C)(C(C)C)C(C)C)=C[C@@H]1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H39NOSi/c1-8-20-13-14-21(27-28(17(2)3,18(4)5)19(6)7)15-23(20)24-16-26-25-12-10-9-11-22(24)25/h9-12,15-20,23,26H,8,13-14H2,1-7H3/t20?,23-/m0/s1 |
| InChIKey | FGYPFXNJXMMOCZ-AKRCKQFNSA-N |
| XLogP | 8.15 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.68 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|