C13H14N2O — CID 123370027
2-ethyl-5-(1H-indol-3-yl)-2,5-dihydro-1,3-oxazole (PubChem CID 123370027) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-ethyl-5-(1H-indol-3-yl)-2,5-dihydro-1,3-oxazole.
| Compound Name | 2-ethyl-5-(1H-indol-3-yl)-2,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 123370027 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-ethyl-5-(1H-indol-3-yl)-2,5-dihydro-1,3-oxazole |
| SMILES | CCC1N=CC(c2c[nH]c3ccccc23)O1 |
| InChI | InChI=1S/C13H14N2O/c1-2-13-15-8-12(16-13)10-7-14-11-6-4-3-5-9(10)11/h3-8,12-14H,2H2,1H3 |
| InChIKey | ITMOVZQJNBTPQO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |