C11H9ClN4O3 — CID 100965270
N-[6-(4-chlorophenyl)-3,5-dioxo-2H-1,2,4-triazin-4-yl]acetamide (PubChem CID 100965270) has the molecular formula C11H9ClN4O3 and a molecular weight of 280.67 g/mol. Its IUPAC name is N-[6-(4-chlorophenyl)-3,5-dioxo-2H-1,2,4-triazin-4-yl]acetamide.
| Compound Name | N-[6-(4-chlorophenyl)-3,5-dioxo-2H-1,2,4-triazin-4-yl]acetamide |
|---|---|
| PubChem CID | 100965270 |
| Molecular Formula | C11H9ClN4O3 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | N-[6-(4-chlorophenyl)-3,5-dioxo-2H-1,2,4-triazin-4-yl]acetamide |
| SMILES | CC(=O)Nn1c(=O)[nH]nc(-c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C11H9ClN4O3/c1-6(17)15-16-10(18)9(13-14-11(16)19)7-2-4-8(12)5-3-7/h2-5H,1H3,(H,14,19)(H,15,17) |
| InChIKey | MXUWDGMPGFHTPI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |