C23H24Cl2IN3O2 — CID 12688607
2-[5-acetyl-3,4-bis(4-chlorophenyl)-6-oxopyridazin-1-yl]ethyl-trimethylazanium iodide (PubChem CID 12688607) has the molecular formula C23H24Cl2IN3O2 and a molecular weight of 572.27 g/mol. Its IUPAC name is 2-[5-acetyl-3,4-bis(4-chlorophenyl)-6-oxopyridazin-1-yl]ethyl-trimethylazanium iodide.
| Compound Name | 2-[5-acetyl-3,4-bis(4-chlorophenyl)-6-oxopyridazin-1-yl]ethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 12688607 |
| Molecular Formula | C23H24Cl2IN3O2 |
| Molecular Weight | 572.27 g/mol |
| Exact Mass | 571.03 |
| IUPAC Name | 2-[5-acetyl-3,4-bis(4-chlorophenyl)-6-oxopyridazin-1-yl]ethyl-trimethylazanium iodide |
| SMILES | CC(=O)c1c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nn(CC[N+](C)(C)C)c1=O.[I-] |
| InChI | InChI=1S/C23H24Cl2N3O2.HI/c1-15(29)20-21(16-5-9-18(24)10-6-16)22(17-7-11-19(25)12-8-17)26-27(23(20)30)13-14-28(2,3)4;/h5-12H,13-14H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | HRJWQYUDJZCRRS-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|