C14H30O2Si — CID 100969416
(3R,4R)-2,2-ditert-butyl-3,4-dimethyloxasilinan-5-ol (PubChem CID 100969416) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is (3R,4R)-2,2-ditert-butyl-3,4-dimethyloxasilinan-5-ol.
| Compound Name | (3R,4R)-2,2-ditert-butyl-3,4-dimethyloxasilinan-5-ol |
|---|---|
| PubChem CID | 100969416 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (3R,4R)-2,2-ditert-butyl-3,4-dimethyloxasilinan-5-ol |
| SMILES | C[C@@H]1C(O)CO[Si](C(C)(C)C)(C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C14H30O2Si/c1-10-11(2)17(13(3,4)5,14(6,7)8)16-9-12(10)15/h10-12,15H,9H2,1-8H3/t10-,11+,12?/m0/s1 |
| InChIKey | UBGGLAZVNBQANP-WIKAKEFZSA-N |
| XLogP | 3.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|