C15H30O3Si — CID 134856615
[(3S,4S)-2,2-ditert-butyl-3,4-dimethyloxasilolan-5-yl] acetate (PubChem CID 134856615) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is [(3S,4S)-2,2-ditert-butyl-3,4-dimethyloxasilolan-5-yl] acetate.
| Compound Name | [(3S,4S)-2,2-ditert-butyl-3,4-dimethyloxasilolan-5-yl] acetate |
|---|---|
| PubChem CID | 134856615 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | [(3S,4S)-2,2-ditert-butyl-3,4-dimethyloxasilolan-5-yl] acetate |
| SMILES | CC(=O)OC1O[Si](C(C)(C)C)(C(C)(C)C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C15H30O3Si/c1-10-11(2)19(14(4,5)6,15(7,8)9)18-13(10)17-12(3)16/h10-11,13H,1-9H3/t10-,11+,13?/m1/s1 |
| InChIKey | VJMCHCTZFDFTKS-ILWADHIDSA-N |
| XLogP | 4.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|