C12H11Br3 — CID 100969762
[2-bromo-1-(2,2-dibromocyclopropyl)cyclopropyl]benzene (PubChem CID 100969762) has the molecular formula C12H11Br3 and a molecular weight of 394.93 g/mol. Its IUPAC name is [2-bromo-1-(2,2-dibromocyclopropyl)cyclopropyl]benzene.
| Compound Name | [2-bromo-1-(2,2-dibromocyclopropyl)cyclopropyl]benzene |
|---|---|
| PubChem CID | 100969762 |
| Molecular Formula | C12H11Br3 |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 391.84 |
| IUPAC Name | [2-bromo-1-(2,2-dibromocyclopropyl)cyclopropyl]benzene |
| SMILES | BrC1CC1(c1ccccc1)C1CC1(Br)Br |
| InChI | InChI=1S/C12H11Br3/c13-10-7-11(10,9-6-12(9,14)15)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2 |
| InChIKey | FTMRFSQRCDWJQQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|