C10H10Br2O2S — CID 7452579
(3R,4S)-3,4-dibromo-3-phenylthiolane 1,1-dioxide (PubChem CID 7452579) has the molecular formula C10H10Br2O2S and a molecular weight of 354.06 g/mol. Its IUPAC name is (3R,4S)-3,4-dibromo-3-phenylthiolane 1,1-dioxide.
| Compound Name | (3R,4S)-3,4-dibromo-3-phenylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 7452579 |
| Molecular Formula | C10H10Br2O2S |
| Molecular Weight | 354.06 g/mol |
| Exact Mass | 351.88 |
| IUPAC Name | (3R,4S)-3,4-dibromo-3-phenylthiolane 1,1-dioxide |
| SMILES | O=S1(=O)C[C@H](Br)[C@@](Br)(c2ccccc2)C1 |
| InChI | InChI=1S/C10H10Br2O2S/c11-9-6-15(13,14)7-10(9,12)8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-,10-/m0/s1 |
| InChIKey | DFPRPSAKDXJTRA-UWVGGRQHSA-N |
| XLogP | 2.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.06 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|