C17H23ClO4S — CID 95565048
2-[[(3aR,5S,6S,7aS)-6-chloro-2,2-dioxo-7a-phenyl-3,3a,4,5,6,7-hexahydro-1H-2-benzothiophen-5-yl]oxy]propan-2-ol (PubChem CID 95565048) has the molecular formula C17H23ClO4S and a molecular weight of 358.89 g/mol. Its IUPAC name is 2-[[(3aR,5S,6S,7aS)-6-chloro-2,2-dioxo-7a-phenyl-3,3a,4,5,6,7-hexahydro-1H-2-benzothiophen-5-yl]oxy]propan-2-ol.
| Compound Name | 2-[[(3aR,5S,6S,7aS)-6-chloro-2,2-dioxo-7a-phenyl-3,3a,4,5,6,7-hexahydro-1H-2-benzothiophen-5-yl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 95565048 |
| Molecular Formula | C17H23ClO4S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-[[(3aR,5S,6S,7aS)-6-chloro-2,2-dioxo-7a-phenyl-3,3a,4,5,6,7-hexahydro-1H-2-benzothiophen-5-yl]oxy]propan-2-ol |
| SMILES | CC(C)(O)O[C@H]1C[C@H]2CS(=O)(=O)C[C@@]2(c2ccccc2)C[C@@H]1Cl |
| InChI | InChI=1S/C17H23ClO4S/c1-16(2,19)22-15-8-13-10-23(20,21)11-17(13,9-14(15)18)12-6-4-3-5-7-12/h3-7,13-15,19H,8-11H2,1-2H3/t13-,14-,15-,17+/m0/s1 |
| InChIKey | OQISDUCVCAAQID-QBYUYEEZSA-N |
| XLogP | 2.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|