C27H35NO2 — CID 155112942
tert-butyl N-benzyl-N-(3-methyl-4-phenyl-1-bicyclo[2.2.2]octanyl)carbamate (PubChem CID 155112942) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-(3-methyl-4-phenyl-1-bicyclo[2.2.2]octanyl)carbamate.
| Compound Name | tert-butyl N-benzyl-N-(3-methyl-4-phenyl-1-bicyclo[2.2.2]octanyl)carbamate |
|---|---|
| PubChem CID | 155112942 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | tert-butyl N-benzyl-N-(3-methyl-4-phenyl-1-bicyclo[2.2.2]octanyl)carbamate |
| SMILES | CC1CC2(N(Cc3ccccc3)C(=O)OC(C)(C)C)CCC1(c1ccccc1)CC2 |
| InChI | InChI=1S/C27H35NO2/c1-21-19-26(15-17-27(21,18-16-26)23-13-9-6-10-14-23)28(24(29)30-25(2,3)4)20-22-11-7-5-8-12-22/h5-14,21H,15-20H2,1-4H3 |
| InChIKey | ZHQVYQIRDUCWKQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |