C29H45B2NO6 — CID 175777297
tert-butyl N-benzyl-N-[2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate (PubChem CID 175777297) has the molecular formula C29H45B2NO6 and a molecular weight of 525.30 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate |
|---|---|
| PubChem CID | 175777297 |
| Molecular Formula | C29H45B2NO6 |
| Molecular Weight | 525.30 g/mol |
| Exact Mass | 525.34 |
| IUPAC Name | tert-butyl N-benzyl-N-[2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)C12CC(B3OC(C)(C)C(C)(C)O3)(C1)C2B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C29H45B2NO6/c1-23(2,3)34-22(33)32(17-20-15-13-12-14-16-20)29-18-28(19-29,31-37-26(8,9)27(10,11)38-31)21(29)30-35-24(4,5)25(6,7)36-30/h12-16,21H,17-19H2,1-11H3 |
| InChIKey | NBCRCCMVBAMHIO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.30 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|