C27H44BNO4 — CID 150555974
tert-butyl N-oct-7-enyl-N-[(1R)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate (PubChem CID 150555974) has the molecular formula C27H44BNO4 and a molecular weight of 457.46 g/mol. Its IUPAC name is tert-butyl N-oct-7-enyl-N-[(1R)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-oct-7-enyl-N-[(1R)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 150555974 |
| Molecular Formula | C27H44BNO4 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.34 |
| IUPAC Name | tert-butyl N-oct-7-enyl-N-[(1R)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate |
| SMILES | C=CCCCCCCN(C(=O)OC(C)(C)C)[C@@](C)(B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C27H44BNO4/c1-10-11-12-13-14-18-21-29(23(30)31-24(2,3)4)27(9,22-19-16-15-17-20-22)28-32-25(5,6)26(7,8)33-28/h10,15-17,19-20H,1,11-14,18,21H2,2-9H3/t27-/m1/s1 |
| InChIKey | IIVUIRYUVSWQET-HHHXNRCGSA-N |
| XLogP | 6.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|