C29H48BNO4 — CID 151141997
tert-butyl N-[(3S)-3,7-dimethyloct-6-enyl]-N-[(1S)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate (PubChem CID 151141997) has the molecular formula C29H48BNO4 and a molecular weight of 485.52 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3,7-dimethyloct-6-enyl]-N-[(1S)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(3S)-3,7-dimethyloct-6-enyl]-N-[(1S)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 151141997 |
| Molecular Formula | C29H48BNO4 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.37 |
| IUPAC Name | tert-butyl N-[(3S)-3,7-dimethyloct-6-enyl]-N-[(1S)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate |
| SMILES | CC(C)=CCC[C@H](C)CCN(C(=O)OC(C)(C)C)[C@](C)(B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C29H48BNO4/c1-22(2)16-15-17-23(3)20-21-31(25(32)33-26(4,5)6)29(11,24-18-13-12-14-19-24)30-34-27(7,8)28(9,10)35-30/h12-14,16,18-19,23H,15,17,20-21H2,1-11H3/t23-,29-/m0/s1 |
| InChIKey | MWJZLMHGOFOJRY-IADCTJSHSA-N |
| XLogP | 7.54 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|