C21H33NO2 — CID 146442226
3,7-dimethyloct-6-enyl-[(1S)-1-phenylbutyl]carbamic acid (PubChem CID 146442226) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl-[(1S)-1-phenylbutyl]carbamic acid.
| Compound Name | 3,7-dimethyloct-6-enyl-[(1S)-1-phenylbutyl]carbamic acid |
|---|---|
| PubChem CID | 146442226 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 3,7-dimethyloct-6-enyl-[(1S)-1-phenylbutyl]carbamic acid |
| SMILES | CCC[C@@H](c1ccccc1)N(CCC(C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C21H33NO2/c1-5-10-20(19-13-7-6-8-14-19)22(21(23)24)16-15-18(4)12-9-11-17(2)3/h6-8,11,13-14,18,20H,5,9-10,12,15-16H2,1-4H3,(H,23,24)/t18?,20-/m0/s1 |
| InChIKey | PBIVMZSFKFLPSW-IJHRGXPZSA-N |
| XLogP | 6.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|