C28H38OSe — CID 162691827
(3R)-3-[(2R,6R)-6,10-dimethylundec-9-en-2-yl]selanyl-1,3-diphenylpropan-1-one (PubChem CID 162691827) has the molecular formula C28H38OSe and a molecular weight of 469.57 g/mol. Its IUPAC name is (3R)-3-[(2R,6R)-6,10-dimethylundec-9-en-2-yl]selanyl-1,3-diphenylpropan-1-one.
| Compound Name | (3R)-3-[(2R,6R)-6,10-dimethylundec-9-en-2-yl]selanyl-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 162691827 |
| Molecular Formula | C28H38OSe |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (3R)-3-[(2R,6R)-6,10-dimethylundec-9-en-2-yl]selanyl-1,3-diphenylpropan-1-one |
| SMILES | CC(C)=CCC[C@H](C)CCC[C@@H](C)[Se][C@H](CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H38OSe/c1-22(2)13-11-14-23(3)15-12-16-24(4)30-28(26-19-9-6-10-20-26)21-27(29)25-17-7-5-8-18-25/h5-10,13,17-20,23-24,28H,11-12,14-16,21H2,1-4H3/t23-,24+,28+/m0/s1 |
| InChIKey | HDDIOTIKMOTBPG-VYKTZEHYSA-N |
| XLogP | 8.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|