C20H33O3PS — CID 10810087
(3,7-dimethyl-1-phenyloct-6-enoxy)-diethoxy-sulfanylidene-lambda5-phosphane (PubChem CID 10810087) has the molecular formula C20H33O3PS and a molecular weight of 384.52 g/mol. Its IUPAC name is (3,7-dimethyl-1-phenyloct-6-enoxy)-diethoxy-sulfanylidene-lambda5-phosphane.
| Compound Name | (3,7-dimethyl-1-phenyloct-6-enoxy)-diethoxy-sulfanylidene-lambda5-phosphane |
|---|---|
| PubChem CID | 10810087 |
| Molecular Formula | C20H33O3PS |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (3,7-dimethyl-1-phenyloct-6-enoxy)-diethoxy-sulfanylidene-lambda5-phosphane |
| SMILES | CCOP(=S)(OCC)OC(CC(C)CCC=C(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H33O3PS/c1-6-21-24(25,22-7-2)23-20(19-14-9-8-10-15-19)16-18(5)13-11-12-17(3)4/h8-10,12,14-15,18,20H,6-7,11,13,16H2,1-5H3 |
| InChIKey | OXAJZRXRMYFMDF-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|