C26H36O3 — CID 100927081
[(4R,6R)-6,10-dimethylundec-9-en-4-yl] 2-methoxy-2-naphthalen-2-ylacetate (PubChem CID 100927081) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is [(4R,6R)-6,10-dimethylundec-9-en-4-yl] 2-methoxy-2-naphthalen-2-ylacetate.
| Compound Name | [(4R,6R)-6,10-dimethylundec-9-en-4-yl] 2-methoxy-2-naphthalen-2-ylacetate |
|---|---|
| PubChem CID | 100927081 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | [(4R,6R)-6,10-dimethylundec-9-en-4-yl] 2-methoxy-2-naphthalen-2-ylacetate |
| SMILES | CCC[C@H](C[C@H](C)CCC=C(C)C)OC(=O)C(OC)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H36O3/c1-6-10-24(17-20(4)12-9-11-19(2)3)29-26(27)25(28-5)23-16-15-21-13-7-8-14-22(21)18-23/h7-8,11,13-16,18,20,24-25H,6,9-10,12,17H2,1-5H3/t20-,24-,25?/m1/s1 |
| InChIKey | IDFDAKHJDIQDLF-XPTUZCQZSA-N |
| XLogP | 7.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|