C21H27IO6S — CID 11800451
(1-iodo-7-methylsulfonyloxyheptan-4-yl) 2-methoxy-2-naphthalen-2-ylacetate (PubChem CID 11800451) has the molecular formula C21H27IO6S and a molecular weight of 534.41 g/mol. Its IUPAC name is (1-iodo-7-methylsulfonyloxyheptan-4-yl) 2-methoxy-2-naphthalen-2-ylacetate.
| Compound Name | (1-iodo-7-methylsulfonyloxyheptan-4-yl) 2-methoxy-2-naphthalen-2-ylacetate |
|---|---|
| PubChem CID | 11800451 |
| Molecular Formula | C21H27IO6S |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | (1-iodo-7-methylsulfonyloxyheptan-4-yl) 2-methoxy-2-naphthalen-2-ylacetate |
| SMILES | COC(C(=O)OC(CCCI)CCCOS(C)(=O)=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H27IO6S/c1-26-20(18-12-11-16-7-3-4-8-17(16)15-18)21(23)28-19(9-5-13-22)10-6-14-27-29(2,24)25/h3-4,7-8,11-12,15,19-20H,5-6,9-10,13-14H2,1-2H3 |
| InChIKey | XLQNPHVHGPZELJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|