About [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate
[(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate (PubChem CID 166437804) has the molecular formula C26H32O6S2
and a molecular weight of 504.67 g/mol. Its IUPAC name is [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate.
Molecular Properties
| Compound Name | [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate |
| PubChem CID | 166437804 |
| Molecular Formula | C26H32O6S2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate |
| SMILES | C[C@@H](C[C@H](CC(CCOS(C)(=O)=O)OS(C)(=O)=O)c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H32O6S2/c1-20(23-14-13-22-11-7-8-12-24(22)18-23)17-25(21-9-5-4-6-10-21)19-26(32-34(3,29)30)15-16-31-33(2,27)28/h4-14,18,20,25-26H,15-17,19H2,1-3H3/t20-,25+,26?/m0/s1 |
| InChIKey | ACDHPASQWBJTFO-VHXDUDQTSA-N |
| XLogP | 5.22 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate?
The IUPAC name of [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate (CID 166437804) is [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate.
What is the SMILES notation for [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate?
The canonical SMILES for [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate is C[C@@H](C[C@H](CC(CCOS(C)(=O)=O)OS(C)(=O)=O)c1ccccc1)c1ccc2ccccc2c1.
What is the InChIKey of [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate?
The InChIKey is ACDHPASQWBJTFO-VHXDUDQTSA-N. The full InChI is InChI=1S/C26H32O6S2/c1-20(23-14-13-22-11-7-8-12-24(22)18-23)17-25(21-9-5-4-6-10-21)19-26(32-34(3,29)30)15-16-31-33(2,27)28/h4-14,18,20,25-26H,15-17,19H2,1-3H3/t20-,25+,26?/m0/s1.
What are the key properties of [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate?
[(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate has a molecular weight of 504.67 g/mol, XLogP of 5.22, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R,7S)-3-methylsulfonyloxy-7-naphthalen-2-yl-5-phenyloctyl] methanesulfonate is sourced from PubChem (CID 166437804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).