C19H24O7S2 — CID 11037362
[(3S)-3-benzhydryloxy-4-methylsulfonyloxybutyl] methanesulfonate (PubChem CID 11037362) has the molecular formula C19H24O7S2 and a molecular weight of 428.53 g/mol. Its IUPAC name is [(3S)-3-benzhydryloxy-4-methylsulfonyloxybutyl] methanesulfonate.
| Compound Name | [(3S)-3-benzhydryloxy-4-methylsulfonyloxybutyl] methanesulfonate |
|---|---|
| PubChem CID | 11037362 |
| Molecular Formula | C19H24O7S2 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [(3S)-3-benzhydryloxy-4-methylsulfonyloxybutyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC[C@@H](COS(C)(=O)=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24O7S2/c1-27(20,21)24-14-13-18(15-25-28(2,22)23)26-19(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18-19H,13-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | AFPMKBLZHCCJLK-SFHVURJKSA-N |
| XLogP | 2.50 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|