C29H45BN2O7 — CID 176808136
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[3-(phenylmethoxymethyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate (PubChem CID 176808136) has the molecular formula C29H45BN2O7 and a molecular weight of 544.50 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[3-(phenylmethoxymethyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[3-(phenylmethoxymethyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate |
|---|---|
| PubChem CID | 176808136 |
| Molecular Formula | C29H45BN2O7 |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[3-(phenylmethoxymethyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)C12CC(COCc3ccccc3)(C1)C2B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C29H45BN2O7/c1-24(2,3)36-22(33)31-32(23(34)37-25(4,5)6)29-17-28(18-29,19-35-16-20-14-12-11-13-15-20)21(29)30-38-26(7,8)27(9,10)39-30/h11-15,21H,16-19H2,1-10H3,(H,31,33) |
| InChIKey | BGZZOBNPAIUJPK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|