C26H40N2O14 — CID 100971422
[3-methyl-1-oxo-1-[[(2S,3R,4R,5S,6R)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]amino]butan-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 100971422) has the molecular formula C26H40N2O14 and a molecular weight of 604.61 g/mol. Its IUPAC name is [3-methyl-1-oxo-1-[[(2S,3R,4R,5S,6R)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]amino]butan-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [3-methyl-1-oxo-1-[[(2S,3R,4R,5S,6R)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]amino]butan-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 100971422 |
| Molecular Formula | C26H40N2O14 |
| Molecular Weight | 604.61 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | [3-methyl-1-oxo-1-[[(2S,3R,4R,5S,6R)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]amino]butan-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](NC(=O)C(OC(=O)CNC(=O)OC(C)(C)C)C(C)C)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H40N2O14/c1-12(2)20(41-18(33)10-27-25(35)42-26(7,8)9)23(34)28-19-22(38-15(5)31)21(37-14(4)30)17(11-36-13(3)29)40-24(19)39-16(6)32/h12,17,19-22,24H,10-11H2,1-9H3,(H,27,35)(H,28,34)/t17-,19-,20?,21-,22-,24-/m1/s1 |
| InChIKey | GYSPBKLGQZXQFC-INJHGAICSA-N |
| XLogP | 0.28 |
| TPSA | 208.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.61 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|