C6H9BrO6 — CID 100973865
(2S,3S,4S,5R,6S)-6-bromo-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 100973865) has the molecular formula C6H9BrO6 and a molecular weight of 257.04 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-bromo-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-bromo-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 100973865 |
| Molecular Formula | C6H9BrO6 |
| Molecular Weight | 257.04 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-bromo-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@@H](Br)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H9BrO6/c7-5-3(10)1(8)2(9)4(13-5)6(11)12/h1-5,8-10H,(H,11,12)/t1-,2-,3+,4-,5+/m0/s1 |
| InChIKey | ZPDVCCQIUSUHKA-CIOUUCGESA-N |
| XLogP | -1.73 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.04 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|