C9H12O10 — CID 131833834
2-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)propanedioic acid (PubChem CID 131833834) has the molecular formula C9H12O10 and a molecular weight of 280.19 g/mol. Its IUPAC name is 2-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)propanedioic acid.
| Compound Name | 2-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)propanedioic acid |
|---|---|
| PubChem CID | 131833834 |
| Molecular Formula | C9H12O10 |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)propanedioic acid |
| SMILES | O=C(O)C1OC(C(C(=O)O)C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C9H12O10/c10-2-3(11)5(1(7(13)14)8(15)16)19-6(4(2)12)9(17)18/h1-6,10-12H,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | XLTABVBFTXNXGH-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|