C6H11O9P — CID 68668798
(3R,4S,5S)-3,4-dihydroxy-5-[hydroxy(phosphono)methyl]oxolane-2-carboxylic acid (PubChem CID 68668798) has the molecular formula C6H11O9P and a molecular weight of 258.12 g/mol. Its IUPAC name is (3R,4S,5S)-3,4-dihydroxy-5-[hydroxy(phosphono)methyl]oxolane-2-carboxylic acid.
| Compound Name | (3R,4S,5S)-3,4-dihydroxy-5-[hydroxy(phosphono)methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 68668798 |
| Molecular Formula | C6H11O9P |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | (3R,4S,5S)-3,4-dihydroxy-5-[hydroxy(phosphono)methyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1O[C@H](C(O)P(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H11O9P/c7-1-2(8)4(6(11)16(12,13)14)15-3(1)5(9)10/h1-4,6-8,11H,(H,9,10)(H2,12,13,14)/t1-,2+,3?,4+,6?/m1/s1 |
| InChIKey | ZWJBVQIBODPGEF-KPUAVOKJSA-N |
| XLogP | -2.94 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|