C16H22O4 — CID 100975791
cyclohexyl (1S,2R,4S,5R)-2,4-dimethyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate (PubChem CID 100975791) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is cyclohexyl (1S,2R,4S,5R)-2,4-dimethyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate.
| Compound Name | cyclohexyl (1S,2R,4S,5R)-2,4-dimethyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate |
|---|---|
| PubChem CID | 100975791 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | cyclohexyl (1S,2R,4S,5R)-2,4-dimethyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-ene-1-carboxylate |
| SMILES | C[C@@H]1C(=O)[C@H](C)[C@]2(C(=O)OC3CCCCC3)C=C[C@H]1O2 |
| InChI | InChI=1S/C16H22O4/c1-10-13-8-9-16(20-13,11(2)14(10)17)15(18)19-12-6-4-3-5-7-12/h8-13H,3-7H2,1-2H3/t10-,11-,13+,16-/m0/s1 |
| InChIKey | WUMLBBMBYJHVDP-NLZNIHBBSA-N |
| XLogP | 2.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|