C53H52N2O11 — CID 100976746
[(2S)-1,4-dioxo-1-phenylmethoxy-4-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]amino]butan-2-yl]carbamoyl benzoate (PubChem CID 100976746) has the molecular formula C53H52N2O11 and a molecular weight of 893.00 g/mol. Its IUPAC name is [(2S)-1,4-dioxo-1-phenylmethoxy-4-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]amino]butan-2-yl]carbamoyl benzoate.
| Compound Name | [(2S)-1,4-dioxo-1-phenylmethoxy-4-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]amino]butan-2-yl]carbamoyl benzoate |
|---|---|
| PubChem CID | 100976746 |
| Molecular Formula | C53H52N2O11 |
| Molecular Weight | 893.00 g/mol |
| Exact Mass | 892.36 |
| IUPAC Name | [(2S)-1,4-dioxo-1-phenylmethoxy-4-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]amino]butan-2-yl]carbamoyl benzoate |
| SMILES | O=C(C[C@H](NC(=O)OC(=O)c1ccccc1)C(=O)OCc1ccccc1)N[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C53H52N2O11/c56-46(31-44(52(58)64-36-42-27-15-5-16-28-42)54-53(59)66-51(57)43-29-17-6-18-30-43)55-50-49(63-35-41-25-13-4-14-26-41)48(62-34-40-23-11-3-12-24-40)47(61-33-39-21-9-2-10-22-39)45(65-50)37-60-32-38-19-7-1-8-20-38/h1-30,44-45,47-50H,31-37H2,(H,54,59)(H,55,56)/t44-,45+,47+,48-,49+,50+/m0/s1 |
| InChIKey | ZSRVIWBYZRYUGT-DKQVNBCKSA-N |
| XLogP | 7.87 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.00 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|