C9H9F10NO — CID 100977956
1-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]pyrrolidine (PubChem CID 100977956) has the molecular formula C9H9F10NO and a molecular weight of 337.16 g/mol. Its IUPAC name is 1-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]pyrrolidine.
| Compound Name | 1-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 100977956 |
| Molecular Formula | C9H9F10NO |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 1-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]pyrrolidine |
| SMILES | FC(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)N1CCCC1 |
| InChI | InChI=1S/C9H9F10NO/c10-5(6(11,12)20-3-1-2-4-20)21-9(18,19)7(13,14)8(15,16)17/h5H,1-4H2 |
| InChIKey | JTTNAWBFQAFNHS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|