C11H20O4S — CID 100978492
ethyl 2-(2-ethylsulfanyloxan-3-yl)-2-hydroxyacetate (PubChem CID 100978492) has the molecular formula C11H20O4S and a molecular weight of 248.34 g/mol. Its IUPAC name is ethyl 2-(2-ethylsulfanyloxan-3-yl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(2-ethylsulfanyloxan-3-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 100978492 |
| Molecular Formula | C11H20O4S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | ethyl 2-(2-ethylsulfanyloxan-3-yl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)C1CCCOC1SCC |
| InChI | InChI=1S/C11H20O4S/c1-3-14-10(13)9(12)8-6-5-7-15-11(8)16-4-2/h8-9,11-12H,3-7H2,1-2H3 |
| InChIKey | LVHMRYJKJSBRDU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |