C18H21NO4 — CID 100980304
dimethyl (Z)-2-[1-methyl-5-(4-methylphenyl)-2,3-dihydropyrrol-4-yl]but-2-enedioate (PubChem CID 100980304) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is dimethyl (Z)-2-[1-methyl-5-(4-methylphenyl)-2,3-dihydropyrrol-4-yl]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[1-methyl-5-(4-methylphenyl)-2,3-dihydropyrrol-4-yl]but-2-enedioate |
|---|---|
| PubChem CID | 100980304 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | dimethyl (Z)-2-[1-methyl-5-(4-methylphenyl)-2,3-dihydropyrrol-4-yl]but-2-enedioate |
| SMILES | COC(=O)/C=C(\C(=O)OC)C1=C(c2ccc(C)cc2)N(C)CC1 |
| InChI | InChI=1S/C18H21NO4/c1-12-5-7-13(8-6-12)17-14(9-10-19(17)2)15(18(21)23-4)11-16(20)22-3/h5-8,11H,9-10H2,1-4H3/b15-11- |
| InChIKey | YAYOHIJXAKFITN-PTNGSMBKSA-N |
| XLogP | 2.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|