C22H17NO5Pd — CID 162401210
dimethyl 2-(1-benzyl-2-oxo-5H-quinolin-5-id-4-yl)but-2-enedioate;palladium(2+) (PubChem CID 162401210) has the molecular formula C22H17NO5Pd and a molecular weight of 481.80 g/mol. Its IUPAC name is dimethyl 2-(1-benzyl-2-oxo-5H-quinolin-5-id-4-yl)but-2-enedioate;palladium(2+).
| Compound Name | dimethyl 2-(1-benzyl-2-oxo-5H-quinolin-5-id-4-yl)but-2-enedioate;palladium(2+) |
|---|---|
| PubChem CID | 162401210 |
| Molecular Formula | C22H17NO5Pd |
| Molecular Weight | 481.80 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | dimethyl 2-(1-benzyl-2-oxo-5H-quinolin-5-id-4-yl)but-2-enedioate;palladium(2+) |
| SMILES | COC(=O)/[C-]=C(\C(=O)OC)c1cc(=O)n(Cc2ccccc2)c2ccc[c-]c12.[Pd+2] |
| InChI | InChI=1S/C22H17NO5.Pd/c1-27-21(25)13-18(22(26)28-2)17-12-20(24)23(14-15-8-4-3-5-9-15)19-11-7-6-10-16(17)19;/h3-9,11-12H,14H2,1-2H3;/q-2;+2 |
| InChIKey | HXRLREZACOELFR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.80 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|