About (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol
(1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol (PubChem CID 100981311) has the molecular formula C8H15OP
and a molecular weight of 158.18 g/mol. Its IUPAC name is (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol.
Molecular Properties
| Compound Name | (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol |
| PubChem CID | 100981311 |
| Molecular Formula | C8H15OP |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol |
| SMILES | CC(C)=CC(O)C/C=C/P |
| InChI | InChI=1S/C8H15OP/c1-7(2)6-8(9)4-3-5-10/h3,5-6,8-9H,4,10H2,1-2H3/b5-3+ |
| InChIKey | WUCJTHFZTUQJJH-HWKANZROSA-N |
| XLogP | 2.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol?
The IUPAC name of (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol (CID 100981311) is (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol.
What is the SMILES notation for (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol?
The canonical SMILES for (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol is CC(C)=CC(O)C/C=C/P.
What is the InChIKey of (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol?
The InChIKey is WUCJTHFZTUQJJH-HWKANZROSA-N. The full InChI is InChI=1S/C8H15OP/c1-7(2)6-8(9)4-3-5-10/h3,5-6,8-9H,4,10H2,1-2H3/b5-3+.
What are the key properties of (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol?
(1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol has a molecular weight of 158.18 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-6-methyl-1-phosphanylhepta-1,5-dien-4-ol is sourced from PubChem (CID 100981311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).