C37H33NO8 — CID 100981937
[(3R,4S,5S,6R)-2-methylidene-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 1,3-dioxoisoindole-2-carboxylate (PubChem CID 100981937) has the molecular formula C37H33NO8 and a molecular weight of 619.67 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-2-methylidene-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 1,3-dioxoisoindole-2-carboxylate.
| Compound Name | [(3R,4S,5S,6R)-2-methylidene-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 1,3-dioxoisoindole-2-carboxylate |
|---|---|
| PubChem CID | 100981937 |
| Molecular Formula | C37H33NO8 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.22 |
| IUPAC Name | [(3R,4S,5S,6R)-2-methylidene-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] 1,3-dioxoisoindole-2-carboxylate |
| SMILES | C=C1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C37H33NO8/c1-25-32(46-37(41)38-35(39)29-19-11-12-20-30(29)36(38)40)34(44-23-28-17-9-4-10-18-28)33(43-22-27-15-7-3-8-16-27)31(45-25)24-42-21-26-13-5-2-6-14-26/h2-20,31-34H,1,21-24H2/t31-,32+,33+,34-/m1/s1 |
| InChIKey | WQMJACQSCGYQFF-ALMGMPQLSA-N |
| XLogP | 6.09 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|