C22H22O3 — CID 100982708
(6S)-12,12-diphenyl-10,11-dioxadispiro[4.0.46.25]dodecan-9-one (PubChem CID 100982708) has the molecular formula C22H22O3 and a molecular weight of 334.41 g/mol. Its IUPAC name is (6S)-12,12-diphenyl-10,11-dioxadispiro[4.0.46.25]dodecan-9-one.
| Compound Name | (6S)-12,12-diphenyl-10,11-dioxadispiro[4.0.46.25]dodecan-9-one |
|---|---|
| PubChem CID | 100982708 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (6S)-12,12-diphenyl-10,11-dioxadispiro[4.0.46.25]dodecan-9-one |
| SMILES | O=C1CC[C@@]2(O1)OC(c1ccccc1)(c1ccccc1)C21CCCC1 |
| InChI | InChI=1S/C22H22O3/c23-19-13-16-21(24-19)20(14-7-8-15-20)22(25-21,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2/t21-/m1/s1 |
| InChIKey | SWDJITQJGQSYAY-OAQYLSRUSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |