C30H43N3O5 — CID 100982788
phenyl N-[1-[[1-[[(2S,3S)-2-hydroxynonan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 100982788) has the molecular formula C30H43N3O5 and a molecular weight of 525.69 g/mol. Its IUPAC name is phenyl N-[1-[[1-[[(2S,3S)-2-hydroxynonan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | phenyl N-[1-[[1-[[(2S,3S)-2-hydroxynonan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 100982788 |
| Molecular Formula | C30H43N3O5 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | phenyl N-[1-[[1-[[(2S,3S)-2-hydroxynonan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCCC[C@H](NC(=O)C(Cc1ccccc1)NC(=O)C(NC(=O)Oc1ccccc1)C(C)C)[C@H](C)O |
| InChI | InChI=1S/C30H43N3O5/c1-5-6-7-14-19-25(22(4)34)31-28(35)26(20-23-15-10-8-11-16-23)32-29(36)27(21(2)3)33-30(37)38-24-17-12-9-13-18-24/h8-13,15-18,21-22,25-27,34H,5-7,14,19-20H2,1-4H3,(H,31,35)(H,32,36)(H,33,37)/t22-,25-,26?,27?/m0/s1 |
| InChIKey | OCUHQCPQBFMDQM-ZCCZHYTLSA-N |
| XLogP | 4.36 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|