C33H46N4O5 — CID 100982791
phenyl N-[1-[[1-[[(2R,3R)-2-hydroxynonan-3-yl]amino]-4-(1H-indol-3-yl)-1-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 100982791) has the molecular formula C33H46N4O5 and a molecular weight of 578.75 g/mol. Its IUPAC name is phenyl N-[1-[[1-[[(2R,3R)-2-hydroxynonan-3-yl]amino]-4-(1H-indol-3-yl)-1-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | phenyl N-[1-[[1-[[(2R,3R)-2-hydroxynonan-3-yl]amino]-4-(1H-indol-3-yl)-1-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 100982791 |
| Molecular Formula | C33H46N4O5 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | phenyl N-[1-[[1-[[(2R,3R)-2-hydroxynonan-3-yl]amino]-4-(1H-indol-3-yl)-1-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCCC[C@@H](NC(=O)C(CCc1c[nH]c2ccccc12)NC(=O)C(NC(=O)Oc1ccccc1)C(C)C)[C@@H](C)O |
| InChI | InChI=1S/C33H46N4O5/c1-5-6-7-11-17-27(23(4)38)35-31(39)29(20-19-24-21-34-28-18-13-12-16-26(24)28)36-32(40)30(22(2)3)37-33(41)42-25-14-9-8-10-15-25/h8-10,12-16,18,21-23,27,29-30,34,38H,5-7,11,17,19-20H2,1-4H3,(H,35,39)(H,36,40)(H,37,41)/t23-,27-,29?,30?/m1/s1 |
| InChIKey | IHBBZDQGXULDQT-QYNMRFRCSA-N |
| XLogP | 5.23 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|