C20H19NO4 — CID 100983187
(2R,3R,5S)-3-hydroxy-2-(hydroxymethyl)-7-methyl-5-phenyl-2,3,5,10-tetrahydropyrano[2,3-b]quinolin-4-one (PubChem CID 100983187) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2R,3R,5S)-3-hydroxy-2-(hydroxymethyl)-7-methyl-5-phenyl-2,3,5,10-tetrahydropyrano[2,3-b]quinolin-4-one.
| Compound Name | (2R,3R,5S)-3-hydroxy-2-(hydroxymethyl)-7-methyl-5-phenyl-2,3,5,10-tetrahydropyrano[2,3-b]quinolin-4-one |
|---|---|
| PubChem CID | 100983187 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2R,3R,5S)-3-hydroxy-2-(hydroxymethyl)-7-methyl-5-phenyl-2,3,5,10-tetrahydropyrano[2,3-b]quinolin-4-one |
| SMILES | Cc1ccc2c(c1)[C@H](c1ccccc1)C1=C(N2)O[C@H](CO)[C@@H](O)C1=O |
| InChI | InChI=1S/C20H19NO4/c1-11-7-8-14-13(9-11)16(12-5-3-2-4-6-12)17-19(24)18(23)15(10-22)25-20(17)21-14/h2-9,15-16,18,21-23H,10H2,1H3/t15-,16+,18-/m1/s1 |
| InChIKey | GLDSBJHGKOBNFE-SOLBZPMBSA-N |
| XLogP | 2.09 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |