C18H21N — CID 156800164
ethane;5-methyl-2-methylidene-3-phenyl-1,3-dihydroindole (PubChem CID 156800164) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is ethane;5-methyl-2-methylidene-3-phenyl-1,3-dihydroindole.
| Compound Name | ethane;5-methyl-2-methylidene-3-phenyl-1,3-dihydroindole |
|---|---|
| PubChem CID | 156800164 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | ethane;5-methyl-2-methylidene-3-phenyl-1,3-dihydroindole |
| SMILES | C=C1Nc2ccc(C)cc2C1c1ccccc1.CC |
| InChI | InChI=1S/C16H15N.C2H6/c1-11-8-9-15-14(10-11)16(12(2)17-15)13-6-4-3-5-7-13;1-2/h3-10,16-17H,2H2,1H3;1-2H3 |
| InChIKey | SEPZJAPRHXBGSC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |