C16H15N — CID 156800165
5-methyl-2-methylidene-3-phenyl-1,3-dihydroindole (PubChem CID 156800165) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is 5-methyl-2-methylidene-3-phenyl-1,3-dihydroindole.
| Compound Name | 5-methyl-2-methylidene-3-phenyl-1,3-dihydroindole |
|---|---|
| PubChem CID | 156800165 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5-methyl-2-methylidene-3-phenyl-1,3-dihydroindole |
| SMILES | C=C1Nc2ccc(C)cc2C1c1ccccc1 |
| InChI | InChI=1S/C16H15N/c1-11-8-9-15-14(10-11)16(12(2)17-15)13-6-4-3-5-7-13/h3-10,16-17H,2H2,1H3 |
| InChIKey | CNLVDAKJOJGUEE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |