C21H19N — CID 7057699
(2R,3R)-5-methyl-2,3-diphenyl-2,3-dihydro-1H-indole (PubChem CID 7057699) has the molecular formula C21H19N and a molecular weight of 285.39 g/mol. Its IUPAC name is (2R,3R)-5-methyl-2,3-diphenyl-2,3-dihydro-1H-indole.
| Compound Name | (2R,3R)-5-methyl-2,3-diphenyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 7057699 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (2R,3R)-5-methyl-2,3-diphenyl-2,3-dihydro-1H-indole |
| SMILES | Cc1ccc2c(c1)[C@@H](c1ccccc1)[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C21H19N/c1-15-12-13-19-18(14-15)20(16-8-4-2-5-9-16)21(22-19)17-10-6-3-7-11-17/h2-14,20-22H,1H3/t20-,21+/m1/s1 |
| InChIKey | ZXBKACYTQXFSBP-RTWAWAEBSA-N |
| XLogP | 5.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |