C8H17NO2 — CID 100983673
(E,2S)-7-[hydroxy(methyl)amino]hept-3-en-2-ol (PubChem CID 100983673) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (E,2S)-7-[hydroxy(methyl)amino]hept-3-en-2-ol.
| Compound Name | (E,2S)-7-[hydroxy(methyl)amino]hept-3-en-2-ol |
|---|---|
| PubChem CID | 100983673 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (E,2S)-7-[hydroxy(methyl)amino]hept-3-en-2-ol |
| SMILES | C[C@H](O)/C=C/CCCN(C)O |
| InChI | InChI=1S/C8H17NO2/c1-8(10)6-4-3-5-7-9(2)11/h4,6,8,10-11H,3,5,7H2,1-2H3/b6-4+/t8-/m0/s1 |
| InChIKey | LUYLREBXGZVFFW-JQTRYQTASA-N |
| XLogP | 1.02 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|