About (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine
(3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine (PubChem CID 100983747) has the molecular formula C6H16N4
and a molecular weight of 144.22 g/mol. Its IUPAC name is (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine.
Molecular Properties
| Compound Name | (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine |
| PubChem CID | 100983747 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine |
| SMILES | NCCN1C[C@@H](N)[C@H](N)C1 |
| InChI | InChI=1S/C6H16N4/c7-1-2-10-3-5(8)6(9)4-10/h5-6H,1-4,7-9H2/t5-,6-/m1/s1 |
| InChIKey | UQEQUSVPWBLVNY-PHDIDXHHSA-N |
| XLogP | -2.08 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine?
The IUPAC name of (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine (CID 100983747) is (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine.
What is the SMILES notation for (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine?
The canonical SMILES for (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine is NCCN1C[C@@H](N)[C@H](N)C1.
What is the InChIKey of (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine?
The InChIKey is UQEQUSVPWBLVNY-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H16N4/c7-1-2-10-3-5(8)6(9)4-10/h5-6H,1-4,7-9H2/t5-,6-/m1/s1.
What are the key properties of (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine?
(3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine has a molecular weight of 144.22 g/mol, XLogP of -2.08, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine is sourced from PubChem (CID 100983747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).