C6H16N4 — CID 100983747
(3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine (PubChem CID 100983747) has the molecular formula C6H16N4 and a molecular weight of 144.22 g/mol. Its IUPAC name is (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine.
| Compound Name | (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine |
|---|---|
| PubChem CID | 100983747 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | (3R,4R)-1-(2-aminoethyl)pyrrolidine-3,4-diamine |
| SMILES | NCCN1C[C@@H](N)[C@H](N)C1 |
| InChI | InChI=1S/C6H16N4/c7-1-2-10-3-5(8)6(9)4-10/h5-6H,1-4,7-9H2/t5-,6-/m1/s1 |
| InChIKey | UQEQUSVPWBLVNY-PHDIDXHHSA-N |
| XLogP | -2.08 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |