C29H35NO — CID 100987217
(3R)-3-[(1S)-1-(dibenzylamino)-2-phenylethyl]hept-1-en-3-ol (PubChem CID 100987217) has the molecular formula C29H35NO and a molecular weight of 413.61 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-(dibenzylamino)-2-phenylethyl]hept-1-en-3-ol.
| Compound Name | (3R)-3-[(1S)-1-(dibenzylamino)-2-phenylethyl]hept-1-en-3-ol |
|---|---|
| PubChem CID | 100987217 |
| Molecular Formula | C29H35NO |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | (3R)-3-[(1S)-1-(dibenzylamino)-2-phenylethyl]hept-1-en-3-ol |
| SMILES | C=C[C@](O)(CCCC)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H35NO/c1-3-5-21-29(31,4-2)28(22-25-15-9-6-10-16-25)30(23-26-17-11-7-12-18-26)24-27-19-13-8-14-20-27/h4,6-20,28,31H,2-3,5,21-24H2,1H3/t28-,29-/m0/s1 |
| InChIKey | FHNBBYPNLGMJLD-VMPREFPWSA-N |
| XLogP | 6.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|