C8H12NO+ — CID 100989788
5-methoxy-1,2-dimethylpyridin-1-ium (PubChem CID 100989788) has the molecular formula C8H12NO+ and a molecular weight of 138.19 g/mol. Its IUPAC name is 5-methoxy-1,2-dimethylpyridin-1-ium.
| Compound Name | 5-methoxy-1,2-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 100989788 |
| Molecular Formula | C8H12NO+ |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 5-methoxy-1,2-dimethylpyridin-1-ium |
| SMILES | COc1ccc(C)[n+](C)c1 |
| InChI | InChI=1S/C8H12NO/c1-7-4-5-8(10-3)6-9(7)2/h4-6H,1-3H3/q+1 |
| InChIKey | KLOWZNZLAJJGHD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|