C15H19N2O3S+ — CID 102506391
N-(4-methoxyphenyl)-1,4,6-trimethylpyridin-1-ium-3-sulfonamide (PubChem CID 102506391) has the molecular formula C15H19N2O3S+ and a molecular weight of 307.40 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,4,6-trimethylpyridin-1-ium-3-sulfonamide.
| Compound Name | N-(4-methoxyphenyl)-1,4,6-trimethylpyridin-1-ium-3-sulfonamide |
|---|---|
| PubChem CID | 102506391 |
| Molecular Formula | C15H19N2O3S+ |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(4-methoxyphenyl)-1,4,6-trimethylpyridin-1-ium-3-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2c[n+](C)c(C)cc2C)cc1 |
| InChI | InChI=1S/C15H19N2O3S/c1-11-9-12(2)17(3)10-15(11)21(18,19)16-13-5-7-14(20-4)8-6-13/h5-10,16H,1-4H3/q+1 |
| InChIKey | NUPHONXNKQJJGN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|