C14H18N3O3S+ — CID 102506396
1-amino-N-(4-methoxyphenyl)-4,6-dimethylpyridin-1-ium-3-sulfonamide (PubChem CID 102506396) has the molecular formula C14H18N3O3S+ and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-amino-N-(4-methoxyphenyl)-4,6-dimethylpyridin-1-ium-3-sulfonamide.
| Compound Name | 1-amino-N-(4-methoxyphenyl)-4,6-dimethylpyridin-1-ium-3-sulfonamide |
|---|---|
| PubChem CID | 102506396 |
| Molecular Formula | C14H18N3O3S+ |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-amino-N-(4-methoxyphenyl)-4,6-dimethylpyridin-1-ium-3-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2c[n+](N)c(C)cc2C)cc1 |
| InChI | InChI=1S/C14H18N3O3S/c1-10-8-11(2)17(15)9-14(10)21(18,19)16-12-4-6-13(20-3)7-5-12/h4-9,16H,15H2,1-3H3/q+1 |
| InChIKey | ODNIOBKEDSKFOI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|