C26H24FNO — CID 100990230
(4R,5Z)-5-[(3-fluorophenyl)methylidene]-2,2,4-trimethyl-3,4-dihydro-1H-chromeno[3,4-f]quinoline (PubChem CID 100990230) has the molecular formula C26H24FNO and a molecular weight of 385.48 g/mol. Its IUPAC name is (4R,5Z)-5-[(3-fluorophenyl)methylidene]-2,2,4-trimethyl-3,4-dihydro-1H-chromeno[3,4-f]quinoline.
| Compound Name | (4R,5Z)-5-[(3-fluorophenyl)methylidene]-2,2,4-trimethyl-3,4-dihydro-1H-chromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 100990230 |
| Molecular Formula | C26H24FNO |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (4R,5Z)-5-[(3-fluorophenyl)methylidene]-2,2,4-trimethyl-3,4-dihydro-1H-chromeno[3,4-f]quinoline |
| SMILES | C[C@@H]1CC(C)(C)Nc2ccc3c(c21)/C(=C/c1cccc(F)c1)Oc1ccccc1-3 |
| InChI | InChI=1S/C26H24FNO/c1-16-15-26(2,3)28-21-12-11-20-19-9-4-5-10-22(19)29-23(25(20)24(16)21)14-17-7-6-8-18(27)13-17/h4-14,16,28H,15H2,1-3H3/b23-14-/t16-/m1/s1 |
| InChIKey | JZSQQWIXOHEGHQ-GMPVXANTSA-N |
| XLogP | 7.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|