C27H24FNO — CID 59971100
(5Z)-9-fluoro-2,2,4-trimethyl-5-[(3-methylphenyl)methylidene]-1H-chromeno[3,4-f]quinoline (PubChem CID 59971100) has the molecular formula C27H24FNO and a molecular weight of 397.49 g/mol. Its IUPAC name is (5Z)-9-fluoro-2,2,4-trimethyl-5-[(3-methylphenyl)methylidene]-1H-chromeno[3,4-f]quinoline.
| Compound Name | (5Z)-9-fluoro-2,2,4-trimethyl-5-[(3-methylphenyl)methylidene]-1H-chromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 59971100 |
| Molecular Formula | C27H24FNO |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (5Z)-9-fluoro-2,2,4-trimethyl-5-[(3-methylphenyl)methylidene]-1H-chromeno[3,4-f]quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1cccc(C)c1)Oc1ccc(F)cc1-3 |
| InChI | InChI=1S/C27H24FNO/c1-16-6-5-7-18(12-16)13-24-26-20(21-14-19(28)8-11-23(21)30-24)9-10-22-25(26)17(2)15-27(3,4)29-22/h5-15,29H,1-4H3/b24-13- |
| InChIKey | ACMHIHPPNKFBLC-CFRMEGHHSA-N |
| XLogP | 7.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|